C64H45N4O2Pt-3 — CID 177303716
CID 177303716 (PubChem CID 177303716) has the molecular formula C64H45N4O2Pt-3 and a molecular weight of 1105.22 g/mol.
| Compound Name | CID 177303716 |
|---|---|
| PubChem CID | 177303716 |
| Molecular Formula | C64H45N4O2Pt-3 |
| Molecular Weight | 1105.22 g/mol |
| Exact Mass | 1104.37 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c3c(c2[2H])c2ccc4[c-]c2n3-c2cc(C(C)(C)C)c(cn2)-c2cccc(c2)Oc2ccc(cc2)-c2cccc(-c3ccccc3)c2N2[CH-]N(c3[c-]c(ccc3)O4)c3ccccc32)c([2H])c1[2H].[Pt] |
| InChI | InChI=1S/C64H45N4O2.Pt/c1-64(2,3)57-39-62-65-40-56(57)46-19-12-21-49(35-46)69-48-30-27-44(28-31-48)53-24-14-23-52(43-17-8-5-9-18-43)63(53)67-41-66(59-25-10-11-26-60(59)67)47-20-13-22-50(37-47)70-51-32-33-54-55-36-45(42-15-6-4-7-16-42)29-34-58(55)68(62)61(54)38-51;/h4-36,39-41H,1-3H3;/q-3;/i4D,6D,7D,15D,16D,29D,34D,36D; |
| InChIKey | HDPYMSMQPSUOSK-CWCSKTGESA-N |
| XLogP | 17.05 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1105.22 |
| LogP ≤ 5 | 17.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|