C13H14ClF3N2O2 — CID 177304083
(2S,6S)-2-[[6-chloro-5-(trifluoromethyl)-3-pyridinyl]oxymethyl]-6-methylpiperidin-4-one (PubChem CID 177304083) has the molecular formula C13H14ClF3N2O2 and a molecular weight of 322.71 g/mol. Its IUPAC name is (2S,6S)-2-[[6-chloro-5-(trifluoromethyl)-3-pyridinyl]oxymethyl]-6-methylpiperidin-4-one.
| Compound Name | (2S,6S)-2-[[6-chloro-5-(trifluoromethyl)-3-pyridinyl]oxymethyl]-6-methylpiperidin-4-one |
|---|---|
| PubChem CID | 177304083 |
| Molecular Formula | C13H14ClF3N2O2 |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | (2S,6S)-2-[[6-chloro-5-(trifluoromethyl)-3-pyridinyl]oxymethyl]-6-methylpiperidin-4-one |
| SMILES | C[C@H]1CC(=O)C[C@@H](COc2cnc(Cl)c(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C13H14ClF3N2O2/c1-7-2-9(20)3-8(19-7)6-21-10-4-11(13(15,16)17)12(14)18-5-10/h4-5,7-8,19H,2-3,6H2,1H3/t7-,8-/m0/s1 |
| InChIKey | KZLRFRBCVURUGK-YUMQZZPRSA-N |
| XLogP | 2.84 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|