C18H22ClF3N2O4 — CID 177304473
tert-butyl (2S,6S)-2-[[6-chloro-5-(trifluoromethyl)-3-pyridinyl]oxymethyl]-6-methyl-4-oxopiperidine-3-carboxylate (PubChem CID 177304473) has the molecular formula C18H22ClF3N2O4 and a molecular weight of 422.83 g/mol. Its IUPAC name is tert-butyl (2S,6S)-2-[[6-chloro-5-(trifluoromethyl)-3-pyridinyl]oxymethyl]-6-methyl-4-oxopiperidine-3-carboxylate.
| Compound Name | tert-butyl (2S,6S)-2-[[6-chloro-5-(trifluoromethyl)-3-pyridinyl]oxymethyl]-6-methyl-4-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 177304473 |
| Molecular Formula | C18H22ClF3N2O4 |
| Molecular Weight | 422.83 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | tert-butyl (2S,6S)-2-[[6-chloro-5-(trifluoromethyl)-3-pyridinyl]oxymethyl]-6-methyl-4-oxopiperidine-3-carboxylate |
| SMILES | C[C@H]1CC(=O)C(C(=O)OC(C)(C)C)[C@@H](COc2cnc(Cl)c(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C18H22ClF3N2O4/c1-9-5-13(25)14(16(26)28-17(2,3)4)12(24-9)8-27-10-6-11(18(20,21)22)15(19)23-7-10/h6-7,9,12,14,24H,5,8H2,1-4H3/t9-,12+,14?/m0/s1 |
| InChIKey | RBUHNQVKMLROSJ-ISLUWDGWSA-N |
| XLogP | 3.41 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.83 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|