C26H37ClN6O2 — CID 177306307
4-[4-(7-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl)piperazin-1-yl]-N-(3,5-dimethoxyphenyl)-6-methylpyrimidin-2-amine (PubChem CID 177306307) has the molecular formula C26H37ClN6O2 and a molecular weight of 501.08 g/mol. Its IUPAC name is 4-[4-(7-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl)piperazin-1-yl]-N-(3,5-dimethoxyphenyl)-6-methylpyrimidin-2-amine.
| Compound Name | 4-[4-(7-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl)piperazin-1-yl]-N-(3,5-dimethoxyphenyl)-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 177306307 |
| Molecular Formula | C26H37ClN6O2 |
| Molecular Weight | 501.08 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 4-[4-(7-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl)piperazin-1-yl]-N-(3,5-dimethoxyphenyl)-6-methylpyrimidin-2-amine |
| SMILES | COc1cc(Nc2nc(C)cc(N3CCN(C4CCNC5CC(Cl)CCC54)CC3)n2)cc(OC)c1 |
| InChI | InChI=1S/C26H37ClN6O2/c1-17-12-25(31-26(29-17)30-19-14-20(34-2)16-21(15-19)35-3)33-10-8-32(9-11-33)24-6-7-28-23-13-18(27)4-5-22(23)24/h12,14-16,18,22-24,28H,4-11,13H2,1-3H3,(H,29,30,31) |
| InChIKey | IBQXTWXAICARHT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.08 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|