About dilithium;prop-1-enyl phosphate
dilithium;prop-1-enyl phosphate (PubChem CID 177307945) has the molecular formula C3H5Li2O4P
and a molecular weight of 149.92 g/mol. Its IUPAC name is dilithium;prop-1-enyl phosphate.
Molecular Properties
| Compound Name | dilithium;prop-1-enyl phosphate |
| PubChem CID | 177307945 |
| Molecular Formula | C3H5Li2O4P |
| Molecular Weight | 149.92 g/mol |
| Exact Mass | 150.02 |
| IUPAC Name | dilithium;prop-1-enyl phosphate |
| SMILES | CC=COP(=O)([O-])[O-].[Li+].[Li+] |
| InChI | InChI=1S/C3H7O4P.2Li/c1-2-3-7-8(4,5)6;;/h2-3H,1H3,(H2,4,5,6);;/q;2*+1/p-2 |
| InChIKey | FIMYUIRXSVNQMX-UHFFFAOYSA-L |
| XLogP | -6.63 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.92 |
| LogP ≤ 5 | -6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dilithium;prop-1-enyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;prop-1-enyl phosphate?
The IUPAC name of dilithium;prop-1-enyl phosphate (CID 177307945) is dilithium;prop-1-enyl phosphate.
What is the SMILES notation for dilithium;prop-1-enyl phosphate?
The canonical SMILES for dilithium;prop-1-enyl phosphate is CC=COP(=O)([O-])[O-].[Li+].[Li+].
What is the InChIKey of dilithium;prop-1-enyl phosphate?
The InChIKey is FIMYUIRXSVNQMX-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H7O4P.2Li/c1-2-3-7-8(4,5)6;;/h2-3H,1H3,(H2,4,5,6);;/q;2*+1/p-2.
What are the key properties of dilithium;prop-1-enyl phosphate?
dilithium;prop-1-enyl phosphate has a molecular weight of 149.92 g/mol, XLogP of -6.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;prop-1-enyl phosphate is sourced from PubChem (CID 177307945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).