About [(Z)-2-cyanoethenyl] phosphate
[(Z)-2-cyanoethenyl] phosphate (PubChem CID 135040715) has the molecular formula C3H2NO4P-2
and a molecular weight of 147.03 g/mol. Its IUPAC name is [(Z)-2-cyanoethenyl] phosphate.
Molecular Properties
| Compound Name | [(Z)-2-cyanoethenyl] phosphate |
| PubChem CID | 135040715 |
| Molecular Formula | C3H2NO4P-2 |
| Molecular Weight | 147.03 g/mol |
| Exact Mass | 146.97 |
| IUPAC Name | [(Z)-2-cyanoethenyl] phosphate |
| SMILES | N#C/C=C\OP(=O)([O-])[O-] |
| InChI | InChI=1S/C3H4NO4P/c4-2-1-3-8-9(5,6)7/h1,3H,(H2,5,6,7)/p-2/b3-1- |
| InChIKey | XVFKTSOTYYSDGQ-IWQZZHSRSA-L |
| XLogP | -1.13 |
| TPSA | 96.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.03 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-2-cyanoethenyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2-cyanoethenyl] phosphate?
The IUPAC name of [(Z)-2-cyanoethenyl] phosphate (CID 135040715) is [(Z)-2-cyanoethenyl] phosphate.
What is the SMILES notation for [(Z)-2-cyanoethenyl] phosphate?
The canonical SMILES for [(Z)-2-cyanoethenyl] phosphate is N#C/C=C\OP(=O)([O-])[O-].
What is the InChIKey of [(Z)-2-cyanoethenyl] phosphate?
The InChIKey is XVFKTSOTYYSDGQ-IWQZZHSRSA-L. The full InChI is InChI=1S/C3H4NO4P/c4-2-1-3-8-9(5,6)7/h1,3H,(H2,5,6,7)/p-2/b3-1-.
What are the key properties of [(Z)-2-cyanoethenyl] phosphate?
[(Z)-2-cyanoethenyl] phosphate has a molecular weight of 147.03 g/mol, XLogP of -1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2-cyanoethenyl] phosphate is sourced from PubChem (CID 135040715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).