About sodium;oxido thiocyanate;phosphate
sodium;oxido thiocyanate;phosphate (PubChem CID 71548576) has the molecular formula CNNaO5PS-3
and a molecular weight of 192.04 g/mol. Its IUPAC name is sodium;oxido thiocyanate;phosphate.
Molecular Properties
| Compound Name | sodium;oxido thiocyanate;phosphate |
| PubChem CID | 71548576 |
| Molecular Formula | CNNaO5PS-3 |
| Molecular Weight | 192.04 g/mol |
| Exact Mass | 191.91 |
| IUPAC Name | sodium;oxido thiocyanate;phosphate |
| SMILES | N#CS[O-].O=P([O-])([O-])[O-].[Na+] |
| InChI | InChI=1S/CHNOS.Na.H3O4P/c2-1-4-3;;1-5(2,3)4/h3H;;(H3,1,2,3,4)/q;+1;/p-4 |
| InChIKey | BDSVPEMOJYFIBQ-UHFFFAOYSA-J |
| XLogP | -5.49 |
| TPSA | 133.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.04 |
| LogP ≤ 5 | -5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;oxido thiocyanate;phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;oxido thiocyanate;phosphate?
The IUPAC name of sodium;oxido thiocyanate;phosphate (CID 71548576) is sodium;oxido thiocyanate;phosphate.
What is the SMILES notation for sodium;oxido thiocyanate;phosphate?
The canonical SMILES for sodium;oxido thiocyanate;phosphate is N#CS[O-].O=P([O-])([O-])[O-].[Na+].
What is the InChIKey of sodium;oxido thiocyanate;phosphate?
The InChIKey is BDSVPEMOJYFIBQ-UHFFFAOYSA-J. The full InChI is InChI=1S/CHNOS.Na.H3O4P/c2-1-4-3;;1-5(2,3)4/h3H;;(H3,1,2,3,4)/q;+1;/p-4.
What are the key properties of sodium;oxido thiocyanate;phosphate?
sodium;oxido thiocyanate;phosphate has a molecular weight of 192.04 g/mol, XLogP of -5.49, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;oxido thiocyanate;phosphate is sourced from PubChem (CID 71548576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).