C22H17N3O2 — CID 177308183
9,16-dimethyl-4-phenyl-2,4,6-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),7(12),8,10,14,16-hexaene-3,5-dione (PubChem CID 177308183) has the molecular formula C22H17N3O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is 9,16-dimethyl-4-phenyl-2,4,6-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),7(12),8,10,14,16-hexaene-3,5-dione.
| Compound Name | 9,16-dimethyl-4-phenyl-2,4,6-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),7(12),8,10,14,16-hexaene-3,5-dione |
|---|---|
| PubChem CID | 177308183 |
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 9,16-dimethyl-4-phenyl-2,4,6-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),7(12),8,10,14,16-hexaene-3,5-dione |
| SMILES | Cc1ccc2c3ccc(C)cc3n3c(=O)n(-c4ccccc4)c(=O)n3c2c1 |
| InChI | InChI=1S/C22H17N3O2/c1-14-8-10-17-18-11-9-15(2)13-20(18)25-22(27)23(16-6-4-3-5-7-16)21(26)24(25)19(17)12-14/h3-13H,1-2H3 |
| InChIKey | CWHRTDMTKUDPNO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|