C20H18N4O3 — CID 162397213
(1S,10R)-15-methyl-11-phenyl-11,13,15,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6-triene-12,14,16-trione (PubChem CID 162397213) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is (1S,10R)-15-methyl-11-phenyl-11,13,15,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6-triene-12,14,16-trione.
| Compound Name | (1S,10R)-15-methyl-11-phenyl-11,13,15,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6-triene-12,14,16-trione |
|---|---|
| PubChem CID | 162397213 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (1S,10R)-15-methyl-11-phenyl-11,13,15,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6-triene-12,14,16-trione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@H]1c3ccccc3CC[C@H]1N(c1ccccc1)C2=O |
| InChI | InChI=1S/C20H18N4O3/c1-21-18(25)23-17-15-10-6-5-7-13(15)11-12-16(17)22(14-8-3-2-4-9-14)20(27)24(23)19(21)26/h2-10,16-17H,11-12H2,1H3/t16-,17+/m1/s1 |
| InChIKey | SZCSZLMPUTZRSL-SJORKVTESA-N |
| XLogP | 1.74 |
| TPSA | 69.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |