C20H12ClN3O2 — CID 177308191
9-chloro-4-phenyl-2,4,6-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),7(12),8,10,13,15-hexaene-3,5-dione (PubChem CID 177308191) has the molecular formula C20H12ClN3O2 and a molecular weight of 361.79 g/mol. Its IUPAC name is 9-chloro-4-phenyl-2,4,6-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),7(12),8,10,13,15-hexaene-3,5-dione.
| Compound Name | 9-chloro-4-phenyl-2,4,6-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),7(12),8,10,13,15-hexaene-3,5-dione |
|---|---|
| PubChem CID | 177308191 |
| Molecular Formula | C20H12ClN3O2 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 9-chloro-4-phenyl-2,4,6-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),7(12),8,10,13,15-hexaene-3,5-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2c3cc(Cl)ccc3c3ccccc3n12 |
| InChI | InChI=1S/C20H12ClN3O2/c21-13-10-11-16-15-8-4-5-9-17(15)23-19(25)22(14-6-2-1-3-7-14)20(26)24(23)18(16)12-13/h1-12H |
| InChIKey | FBNBPAHZMXESHM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|