C15H24FN5O3 — CID 177309149
3-[2-[fluoro(piperidin-4-yl)methyl]-4-methyl-6-oxopiperazin-1-yl]piperazine-2,6-dione (PubChem CID 177309149) has the molecular formula C15H24FN5O3 and a molecular weight of 341.39 g/mol. Its IUPAC name is 3-[2-[fluoro(piperidin-4-yl)methyl]-4-methyl-6-oxopiperazin-1-yl]piperazine-2,6-dione.
| Compound Name | 3-[2-[fluoro(piperidin-4-yl)methyl]-4-methyl-6-oxopiperazin-1-yl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 177309149 |
| Molecular Formula | C15H24FN5O3 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 3-[2-[fluoro(piperidin-4-yl)methyl]-4-methyl-6-oxopiperazin-1-yl]piperazine-2,6-dione |
| SMILES | CN1CC(=O)N(C2NCC(=O)NC2=O)C(C(F)C2CCNCC2)C1 |
| InChI | InChI=1S/C15H24FN5O3/c1-20-7-10(13(16)9-2-4-17-5-3-9)21(12(23)8-20)14-15(24)19-11(22)6-18-14/h9-10,13-14,17-18H,2-8H2,1H3,(H,19,22,24) |
| InChIKey | WVXFNOOLGOTLEM-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|