C23H18Cl2N8 — CID 177309278
N-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]-9-ethyl-2-indol-1-ylpurin-6-amine (PubChem CID 177309278) has the molecular formula C23H18Cl2N8 and a molecular weight of 477.36 g/mol. Its IUPAC name is N-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]-9-ethyl-2-indol-1-ylpurin-6-amine.
| Compound Name | N-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]-9-ethyl-2-indol-1-ylpurin-6-amine |
|---|---|
| PubChem CID | 177309278 |
| Molecular Formula | C23H18Cl2N8 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | N-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]-9-ethyl-2-indol-1-ylpurin-6-amine |
| SMILES | CCn1cnc2c(NCc3nc4cc(Cl)c(Cl)cc4[nH]3)nc(-n3ccc4ccccc43)nc21 |
| InChI | InChI=1S/C23H18Cl2N8/c1-2-32-12-27-20-21(26-11-19-28-16-9-14(24)15(25)10-17(16)29-19)30-23(31-22(20)32)33-8-7-13-5-3-4-6-18(13)33/h3-10,12H,2,11H2,1H3,(H,28,29)(H,26,30,31) |
| InChIKey | AVHPGKCDFHXAGT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |