About dichloro (4-cyanophenyl) phosphate
dichloro (4-cyanophenyl) phosphate (PubChem CID 177310263) has the molecular formula C7H4Cl2NO4P
and a molecular weight of 267.99 g/mol. Its IUPAC name is dichloro (4-cyanophenyl) phosphate.
Molecular Properties
| Compound Name | dichloro (4-cyanophenyl) phosphate |
| PubChem CID | 177310263 |
| Molecular Formula | C7H4Cl2NO4P |
| Molecular Weight | 267.99 g/mol |
| Exact Mass | 266.93 |
| IUPAC Name | dichloro (4-cyanophenyl) phosphate |
| SMILES | N#Cc1ccc(OP(=O)(OCl)OCl)cc1 |
| InChI | InChI=1S/C7H4Cl2NO4P/c8-13-15(11,14-9)12-7-3-1-6(5-10)2-4-7/h1-4H |
| InChIKey | WMPRGFMTZFCFKT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.99 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloro (4-cyanophenyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro (4-cyanophenyl) phosphate?
The IUPAC name of dichloro (4-cyanophenyl) phosphate (CID 177310263) is dichloro (4-cyanophenyl) phosphate.
What is the SMILES notation for dichloro (4-cyanophenyl) phosphate?
The canonical SMILES for dichloro (4-cyanophenyl) phosphate is N#Cc1ccc(OP(=O)(OCl)OCl)cc1.
What is the InChIKey of dichloro (4-cyanophenyl) phosphate?
The InChIKey is WMPRGFMTZFCFKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl2NO4P/c8-13-15(11,14-9)12-7-3-1-6(5-10)2-4-7/h1-4H.
What are the key properties of dichloro (4-cyanophenyl) phosphate?
dichloro (4-cyanophenyl) phosphate has a molecular weight of 267.99 g/mol, XLogP of 3.39, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro (4-cyanophenyl) phosphate is sourced from PubChem (CID 177310263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).