C23H26N2O2 — CID 177311349
tert-butyl 4-[(1S,3S)-3-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]benzoate (PubChem CID 177311349) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is tert-butyl 4-[(1S,3S)-3-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]benzoate.
| Compound Name | tert-butyl 4-[(1S,3S)-3-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]benzoate |
|---|---|
| PubChem CID | 177311349 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | tert-butyl 4-[(1S,3S)-3-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]benzoate |
| SMILES | C[C@H]1Cc2c([nH]c3ccccc23)[C@H](c2ccc(C(=O)OC(C)(C)C)cc2)N1 |
| InChI | InChI=1S/C23H26N2O2/c1-14-13-18-17-7-5-6-8-19(17)25-21(18)20(24-14)15-9-11-16(12-10-15)22(26)27-23(2,3)4/h5-12,14,20,24-25H,13H2,1-4H3/t14-,20-/m0/s1 |
| InChIKey | XULKQLHEKNFTPJ-XOBRGWDASA-N |
| XLogP | 4.75 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|