C24H22N4O — CID 139446855
4-[(1R,3S)-3-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-N-pyridin-2-ylbenzamide (PubChem CID 139446855) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is 4-[(1R,3S)-3-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[(1R,3S)-3-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 139446855 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 4-[(1R,3S)-3-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-N-pyridin-2-ylbenzamide |
| SMILES | C[C@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(C(=O)Nc3ccccn3)cc2)N1 |
| InChI | InChI=1S/C24H22N4O/c1-15-14-19-18-6-2-3-7-20(18)27-23(19)22(26-15)16-9-11-17(12-10-16)24(29)28-21-8-4-5-13-25-21/h2-13,15,22,26-27H,14H2,1H3,(H,25,28,29)/t15-,22+/m0/s1 |
| InChIKey | AHSFDTHQDHXHOD-OYHNWAKOSA-N |
| XLogP | 4.44 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|