C17H12N4O — CID 11644941
N-pyridin-2-yl-9H-pyrido[2,3-b]indole-6-carboxamide (PubChem CID 11644941) has the molecular formula C17H12N4O and a molecular weight of 288.31 g/mol. Its IUPAC name is N-pyridin-2-yl-9H-pyrido[2,3-b]indole-6-carboxamide.
| Compound Name | N-pyridin-2-yl-9H-pyrido[2,3-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 11644941 |
| Molecular Formula | C17H12N4O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | N-pyridin-2-yl-9H-pyrido[2,3-b]indole-6-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1ccc2[nH]c3ncccc3c2c1 |
| InChI | InChI=1S/C17H12N4O/c22-17(21-15-5-1-2-8-18-15)11-6-7-14-13(10-11)12-4-3-9-19-16(12)20-14/h1-10H,(H,19,20)(H,18,21,22) |
| InChIKey | VMGDPDINMFHLLT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |