C12H11BClNO — CID 177314839
5-chloro-6-formyl-7-methyl-3,4-dihydro-1H-2-benzoborinine-2-carbonitrile (PubChem CID 177314839) has the molecular formula C12H11BClNO and a molecular weight of 231.49 g/mol. Its IUPAC name is 5-chloro-6-formyl-7-methyl-3,4-dihydro-1H-2-benzoborinine-2-carbonitrile.
| Compound Name | 5-chloro-6-formyl-7-methyl-3,4-dihydro-1H-2-benzoborinine-2-carbonitrile |
|---|---|
| PubChem CID | 177314839 |
| Molecular Formula | C12H11BClNO |
| Molecular Weight | 231.49 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 5-chloro-6-formyl-7-methyl-3,4-dihydro-1H-2-benzoborinine-2-carbonitrile |
| SMILES | Cc1cc2c(c(Cl)c1C=O)CCB(C#N)C2 |
| InChI | InChI=1S/C12H11BClNO/c1-8-4-9-5-13(7-15)3-2-10(9)12(14)11(8)6-16/h4,6H,2-3,5H2,1H3 |
| InChIKey | FTCJWKBYYSQPBK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|