C20H16FN3O4 — CID 177316676
[4-[[5-(4-fluorophenyl)-2-nitro-3-pyridinyl]amino]phenyl]methyl acetate (PubChem CID 177316676) has the molecular formula C20H16FN3O4 and a molecular weight of 381.36 g/mol. Its IUPAC name is [4-[[5-(4-fluorophenyl)-2-nitro-3-pyridinyl]amino]phenyl]methyl acetate.
| Compound Name | [4-[[5-(4-fluorophenyl)-2-nitro-3-pyridinyl]amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 177316676 |
| Molecular Formula | C20H16FN3O4 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | [4-[[5-(4-fluorophenyl)-2-nitro-3-pyridinyl]amino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(Nc2cc(-c3ccc(F)cc3)cnc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H16FN3O4/c1-13(25)28-12-14-2-8-18(9-3-14)23-19-10-16(11-22-20(19)24(26)27)15-4-6-17(21)7-5-15/h2-11,23H,12H2,1H3 |
| InChIKey | PEXRSMNDPGAQGO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|