C23H17FN6O2 — CID 177317093
[4-[5-(5-fluoro-2-pyridinyl)-2-(1-hydroxy-2-imino-3-pyridinyl)imidazo[4,5-b]pyridin-3-yl]phenyl]methanol (PubChem CID 177317093) has the molecular formula C23H17FN6O2 and a molecular weight of 428.43 g/mol. Its IUPAC name is [4-[5-(5-fluoro-2-pyridinyl)-2-(1-hydroxy-2-imino-3-pyridinyl)imidazo[4,5-b]pyridin-3-yl]phenyl]methanol.
| Compound Name | [4-[5-(5-fluoro-2-pyridinyl)-2-(1-hydroxy-2-imino-3-pyridinyl)imidazo[4,5-b]pyridin-3-yl]phenyl]methanol |
|---|---|
| PubChem CID | 177317093 |
| Molecular Formula | C23H17FN6O2 |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [4-[5-(5-fluoro-2-pyridinyl)-2-(1-hydroxy-2-imino-3-pyridinyl)imidazo[4,5-b]pyridin-3-yl]phenyl]methanol |
| SMILES | [H]/N=c1/c(-c2nc3ccc(-c4ccc(F)cn4)nc3n2-c2ccc(CO)cc2)cccn1O |
| InChI | InChI=1S/C23H17FN6O2/c24-15-5-8-18(26-12-15)19-9-10-20-23(27-19)30(16-6-3-14(13-31)4-7-16)22(28-20)17-2-1-11-29(32)21(17)25/h1-12,25,31-32H,13H2/b25-21- |
| InChIKey | OUMUDLPIMVBGDE-DAFNUICNSA-N |
| XLogP | 3.30 |
| TPSA | 112.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|