C23H18FN6O+ — CID 177316714
3-[5-(5-fluoro-2-pyridinyl)-3-(4-methylphenyl)imidazo[4,5-b]pyridin-2-yl]-1-hydroxypyridin-1-ium-2-amine (PubChem CID 177316714) has the molecular formula C23H18FN6O+ and a molecular weight of 413.44 g/mol. Its IUPAC name is 3-[5-(5-fluoro-2-pyridinyl)-3-(4-methylphenyl)imidazo[4,5-b]pyridin-2-yl]-1-hydroxypyridin-1-ium-2-amine.
| Compound Name | 3-[5-(5-fluoro-2-pyridinyl)-3-(4-methylphenyl)imidazo[4,5-b]pyridin-2-yl]-1-hydroxypyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 177316714 |
| Molecular Formula | C23H18FN6O+ |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 3-[5-(5-fluoro-2-pyridinyl)-3-(4-methylphenyl)imidazo[4,5-b]pyridin-2-yl]-1-hydroxypyridin-1-ium-2-amine |
| SMILES | Cc1ccc(-n2c(-c3ccc[n+](O)c3N)nc3ccc(-c4ccc(F)cn4)nc32)cc1 |
| InChI | InChI=1S/C23H17FN6O/c1-14-4-7-16(8-5-14)30-22(17-3-2-12-29(31)21(17)25)28-20-11-10-19(27-23(20)30)18-9-6-15(24)13-26-18/h2-13,25,31H,1H3/p+1 |
| InChIKey | NUVHWDXKJAJWRT-UHFFFAOYSA-O |
| XLogP | 3.70 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|