C22H35N7O2 — CID 177317161
2-[butyl-[2,5-diamino-6-[[4-[(2-methoxyethylamino)methyl]phenyl]methyliminomethyl]pyrimidin-4-yl]amino]ethanol (PubChem CID 177317161) has the molecular formula C22H35N7O2 and a molecular weight of 429.57 g/mol. Its IUPAC name is 2-[butyl-[2,5-diamino-6-[[4-[(2-methoxyethylamino)methyl]phenyl]methyliminomethyl]pyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[butyl-[2,5-diamino-6-[[4-[(2-methoxyethylamino)methyl]phenyl]methyliminomethyl]pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 177317161 |
| Molecular Formula | C22H35N7O2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | 2-[butyl-[2,5-diamino-6-[[4-[(2-methoxyethylamino)methyl]phenyl]methyliminomethyl]pyrimidin-4-yl]amino]ethanol |
| SMILES | CCCCN(CCO)c1nc(N)nc(/C=N/Cc2ccc(CNCCOC)cc2)c1N |
| InChI | InChI=1S/C22H35N7O2/c1-3-4-10-29(11-12-30)21-20(23)19(27-22(24)28-21)16-26-15-18-7-5-17(6-8-18)14-25-9-13-31-2/h5-8,16,25,30H,3-4,9-15,23H2,1-2H3,(H2,24,27,28)/b26-16+ |
| InChIKey | VGXUKEYMGMNEER-WGOQTCKBSA-N |
| XLogP | 1.59 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|