C14H26N2O — CID 177317182
methanamine;N-(4-methylcyclohex-3-en-1-yl)-2-oxaspiro[3.3]heptan-6-amine (PubChem CID 177317182) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is methanamine;N-(4-methylcyclohex-3-en-1-yl)-2-oxaspiro[3.3]heptan-6-amine.
| Compound Name | methanamine;N-(4-methylcyclohex-3-en-1-yl)-2-oxaspiro[3.3]heptan-6-amine |
|---|---|
| PubChem CID | 177317182 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | methanamine;N-(4-methylcyclohex-3-en-1-yl)-2-oxaspiro[3.3]heptan-6-amine |
| SMILES | CC1=CCC(NC2CC3(COC3)C2)CC1.CN |
| InChI | InChI=1S/C13H21NO.CH5N/c1-10-2-4-11(5-3-10)14-12-6-13(7-12)8-15-9-13;1-2/h2,11-12,14H,3-9H2,1H3;2H2,1H3 |
| InChIKey | BGSIGCDSSURZFK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|