About ethane;1-methylcyclohexene;2-oxaspiro[3.3]heptan-6-amine
ethane;1-methylcyclohexene;2-oxaspiro[3.3]heptan-6-amine (PubChem CID 177317232) has the molecular formula C15H29NO
and a molecular weight of 239.40 g/mol. Its IUPAC name is ethane;1-methylcyclohexene;2-oxaspiro[3.3]heptan-6-amine.
Molecular Properties
| Compound Name | ethane;1-methylcyclohexene;2-oxaspiro[3.3]heptan-6-amine |
| PubChem CID | 177317232 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | ethane;1-methylcyclohexene;2-oxaspiro[3.3]heptan-6-amine |
| SMILES | CC.CC1=CCCCC1.NC1CC2(COC2)C1 |
| InChI | InChI=1S/C7H12.C6H11NO.C2H6/c1-7-5-3-2-4-6-7;7-5-1-6(2-5)3-8-4-6;1-2/h5H,2-4,6H2,1H3;5H,1-4,7H2;1-2H3 |
| InChIKey | LMMGZUNMJYHHQH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methylcyclohexene;2-oxaspiro[3.3]heptan-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylcyclohexene;2-oxaspiro[3.3]heptan-6-amine?
The IUPAC name of ethane;1-methylcyclohexene;2-oxaspiro[3.3]heptan-6-amine (CID 177317232) is ethane;1-methylcyclohexene;2-oxaspiro[3.3]heptan-6-amine.
What is the SMILES notation for ethane;1-methylcyclohexene;2-oxaspiro[3.3]heptan-6-amine?
The canonical SMILES for ethane;1-methylcyclohexene;2-oxaspiro[3.3]heptan-6-amine is CC.CC1=CCCCC1.NC1CC2(COC2)C1.
What is the InChIKey of ethane;1-methylcyclohexene;2-oxaspiro[3.3]heptan-6-amine?
The InChIKey is LMMGZUNMJYHHQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12.C6H11NO.C2H6/c1-7-5-3-2-4-6-7;7-5-1-6(2-5)3-8-4-6;1-2/h5H,2-4,6H2,1H3;5H,1-4,7H2;1-2H3.
What are the key properties of ethane;1-methylcyclohexene;2-oxaspiro[3.3]heptan-6-amine?
ethane;1-methylcyclohexene;2-oxaspiro[3.3]heptan-6-amine has a molecular weight of 239.40 g/mol, XLogP of 3.66, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylcyclohexene;2-oxaspiro[3.3]heptan-6-amine is sourced from PubChem (CID 177317232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).