C17H18N4O3S3 — CID 177318952
N-(3-cyano-4-methyl-1H-indol-7-yl)-2-(2-ethylsulfanylethoxy)-1,3-thiazole-5-sulfonamide (PubChem CID 177318952) has the molecular formula C17H18N4O3S3 and a molecular weight of 422.56 g/mol. Its IUPAC name is N-(3-cyano-4-methyl-1H-indol-7-yl)-2-(2-ethylsulfanylethoxy)-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(3-cyano-4-methyl-1H-indol-7-yl)-2-(2-ethylsulfanylethoxy)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 177318952 |
| Molecular Formula | C17H18N4O3S3 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | N-(3-cyano-4-methyl-1H-indol-7-yl)-2-(2-ethylsulfanylethoxy)-1,3-thiazole-5-sulfonamide |
| SMILES | CCSCCOc1ncc(S(=O)(=O)Nc2ccc(C)c3c(C#N)c[nH]c23)s1 |
| InChI | InChI=1S/C17H18N4O3S3/c1-3-25-7-6-24-17-20-10-14(26-17)27(22,23)21-13-5-4-11(2)15-12(8-18)9-19-16(13)15/h4-5,9-10,19,21H,3,6-7H2,1-2H3 |
| InChIKey | OPWXKJRRIRZWCX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|