C13H11N5O2S2 — CID 172572539
2-amino-N-(3-cyano-4-methyl-1H-indol-7-yl)-1,3-thiazole-5-sulfonamide (PubChem CID 172572539) has the molecular formula C13H11N5O2S2 and a molecular weight of 333.40 g/mol. Its IUPAC name is 2-amino-N-(3-cyano-4-methyl-1H-indol-7-yl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-amino-N-(3-cyano-4-methyl-1H-indol-7-yl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 172572539 |
| Molecular Formula | C13H11N5O2S2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 2-amino-N-(3-cyano-4-methyl-1H-indol-7-yl)-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cnc(N)s2)c2[nH]cc(C#N)c12 |
| InChI | InChI=1S/C13H11N5O2S2/c1-7-2-3-9(12-11(7)8(4-14)5-16-12)18-22(19,20)10-6-17-13(15)21-10/h2-3,5-6,16,18H,1H3,(H2,15,17) |
| InChIKey | WJOJPMCLNVKHAA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |