C11H21NO — CID 177320206
(2Z)-2-methoxy-N,4,5-trimethylhepta-2,4-dien-1-amine (PubChem CID 177320206) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (2Z)-2-methoxy-N,4,5-trimethylhepta-2,4-dien-1-amine.
| Compound Name | (2Z)-2-methoxy-N,4,5-trimethylhepta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 177320206 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (2Z)-2-methoxy-N,4,5-trimethylhepta-2,4-dien-1-amine |
| SMILES | CCC(C)=C(C)/C=C(/CNC)OC |
| InChI | InChI=1S/C11H21NO/c1-6-9(2)10(3)7-11(13-5)8-12-4/h7,12H,6,8H2,1-5H3/b10-9?,11-7- |
| InChIKey | QEZMUEYCJHKKLX-ICZFORBESA-N |
| XLogP | 2.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|