C14H32N2O2 — CID 177320311
butane;ethane;N-[[3-(ethylaminomethyl)oxetan-3-yl]methyl]formamide (PubChem CID 177320311) has the molecular formula C14H32N2O2 and a molecular weight of 260.42 g/mol. Its IUPAC name is butane;ethane;N-[[3-(ethylaminomethyl)oxetan-3-yl]methyl]formamide.
| Compound Name | butane;ethane;N-[[3-(ethylaminomethyl)oxetan-3-yl]methyl]formamide |
|---|---|
| PubChem CID | 177320311 |
| Molecular Formula | C14H32N2O2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | butane;ethane;N-[[3-(ethylaminomethyl)oxetan-3-yl]methyl]formamide |
| SMILES | CC.CCCC.CCNCC1(CNC=O)COC1 |
| InChI | InChI=1S/C8H16N2O2.C4H10.C2H6/c1-2-9-3-8(4-10-7-11)5-12-6-8;1-3-4-2;1-2/h7,9H,2-6H2,1H3,(H,10,11);3-4H2,1-2H3;1-2H3 |
| InChIKey | RXAPGVRZMOGRDZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|