C42H41ClFN3O5 — CID 177320447
1-[2-(4-chlorophenyl)-1H-indol-3-yl]-2-[4-[2-[2-[[2-[2-(4-fluorophenyl)ethyl]-1-benzofuran-6-yl]methylamino]ethoxy]ethoxy]piperidin-1-yl]ethane-1,2-dione (PubChem CID 177320447) has the molecular formula C42H41ClFN3O5 and a molecular weight of 722.26 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-1H-indol-3-yl]-2-[4-[2-[2-[[2-[2-(4-fluorophenyl)ethyl]-1-benzofuran-6-yl]methylamino]ethoxy]ethoxy]piperidin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[2-(4-chlorophenyl)-1H-indol-3-yl]-2-[4-[2-[2-[[2-[2-(4-fluorophenyl)ethyl]-1-benzofuran-6-yl]methylamino]ethoxy]ethoxy]piperidin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 177320447 |
| Molecular Formula | C42H41ClFN3O5 |
| Molecular Weight | 722.26 g/mol |
| Exact Mass | 721.27 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-1H-indol-3-yl]-2-[4-[2-[2-[[2-[2-(4-fluorophenyl)ethyl]-1-benzofuran-6-yl]methylamino]ethoxy]ethoxy]piperidin-1-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCC(OCCOCCNCc2ccc3cc(CCc4ccc(F)cc4)oc3c2)CC1)c1c(-c2ccc(Cl)cc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C42H41ClFN3O5/c43-32-12-10-30(11-13-32)40-39(36-3-1-2-4-37(36)46-40)41(48)42(49)47-20-17-34(18-21-47)51-24-23-50-22-19-45-27-29-5-9-31-26-35(52-38(31)25-29)16-8-28-6-14-33(44)15-7-28/h1-7,9-15,25-26,34,45-46H,8,16-24,27H2 |
| InChIKey | AUOJDTHMWHLERU-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.26 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|