C22H22FN7O3S — CID 177323414
N-[(6-fluoroquinazolin-5-yl)methyl]-1,5-dimethyl-4-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-ylsulfonyl)pyrrole-2-carboxamide (PubChem CID 177323414) has the molecular formula C22H22FN7O3S and a molecular weight of 483.53 g/mol. Its IUPAC name is N-[(6-fluoroquinazolin-5-yl)methyl]-1,5-dimethyl-4-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-ylsulfonyl)pyrrole-2-carboxamide.
| Compound Name | N-[(6-fluoroquinazolin-5-yl)methyl]-1,5-dimethyl-4-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-ylsulfonyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 177323414 |
| Molecular Formula | C22H22FN7O3S |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | N-[(6-fluoroquinazolin-5-yl)methyl]-1,5-dimethyl-4-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-ylsulfonyl)pyrrole-2-carboxamide |
| SMILES | Cc1c(S(=O)(=O)N2CCc3[nH]ncc3C2)cc(C(=O)NCc2c(F)ccc3ncncc23)n1C |
| InChI | InChI=1S/C22H22FN7O3S/c1-13-21(34(32,33)30-6-5-18-14(11-30)8-27-28-18)7-20(29(13)2)22(31)25-10-15-16-9-24-12-26-19(16)4-3-17(15)23/h3-4,7-9,12H,5-6,10-11H2,1-2H3,(H,25,31)(H,27,28) |
| InChIKey | RSSHCJCNYJOQCI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |