C23H25N7O3S — CID 177323568
1,5-dimethyl-4-[[(7R)-7-methyl-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl]sulfonyl]-N-(quinazolin-5-ylmethyl)pyrrole-2-carboxamide (PubChem CID 177323568) has the molecular formula C23H25N7O3S and a molecular weight of 479.57 g/mol. Its IUPAC name is 1,5-dimethyl-4-[[(7R)-7-methyl-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl]sulfonyl]-N-(quinazolin-5-ylmethyl)pyrrole-2-carboxamide.
| Compound Name | 1,5-dimethyl-4-[[(7R)-7-methyl-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl]sulfonyl]-N-(quinazolin-5-ylmethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 177323568 |
| Molecular Formula | C23H25N7O3S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 1,5-dimethyl-4-[[(7R)-7-methyl-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl]sulfonyl]-N-(quinazolin-5-ylmethyl)pyrrole-2-carboxamide |
| SMILES | Cc1c(S(=O)(=O)N2Cc3cn[nH]c3[C@H](C)C2)cc(C(=O)NCc2cccc3ncncc23)n1C |
| InChI | InChI=1S/C23H25N7O3S/c1-14-11-30(12-17-9-27-28-22(14)17)34(32,33)21-7-20(29(3)15(21)2)23(31)25-8-16-5-4-6-19-18(16)10-24-13-26-19/h4-7,9-10,13-14H,8,11-12H2,1-3H3,(H,25,31)(H,27,28)/t14-/m1/s1 |
| InChIKey | VWPOVKVZFNHFJO-CQSZACIVSA-N |
| XLogP | 2.24 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |