C12H13F3N2OSe — CID 177324181
[5-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]selenophen-2-yl]methanol (PubChem CID 177324181) has the molecular formula C12H13F3N2OSe and a molecular weight of 337.20 g/mol. Its IUPAC name is [5-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]selenophen-2-yl]methanol.
| Compound Name | [5-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]selenophen-2-yl]methanol |
|---|---|
| PubChem CID | 177324181 |
| Molecular Formula | C12H13F3N2OSe |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | [5-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]selenophen-2-yl]methanol |
| SMILES | CC(C)n1cc(C(F)(F)F)nc1-c1ccc(CO)[se]1 |
| InChI | InChI=1S/C12H13F3N2OSe/c1-7(2)17-5-10(12(13,14)15)16-11(17)9-4-3-8(6-18)19-9/h3-5,7,18H,6H2,1-2H3 |
| InChIKey | CGJDXNSFLLZCSV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|