C21H25F3N4O2 — CID 177328210
4-cyclohexyl-6-morpholin-4-yl-2-[[3-(trifluoromethyl)-2-pyridinyl]methyl]pyridazin-3-one (PubChem CID 177328210) has the molecular formula C21H25F3N4O2 and a molecular weight of 422.45 g/mol. Its IUPAC name is 4-cyclohexyl-6-morpholin-4-yl-2-[[3-(trifluoromethyl)-2-pyridinyl]methyl]pyridazin-3-one.
| Compound Name | 4-cyclohexyl-6-morpholin-4-yl-2-[[3-(trifluoromethyl)-2-pyridinyl]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 177328210 |
| Molecular Formula | C21H25F3N4O2 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 4-cyclohexyl-6-morpholin-4-yl-2-[[3-(trifluoromethyl)-2-pyridinyl]methyl]pyridazin-3-one |
| SMILES | O=c1c(C2CCCCC2)cc(N2CCOCC2)nn1Cc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C21H25F3N4O2/c22-21(23,24)17-7-4-8-25-18(17)14-28-20(29)16(15-5-2-1-3-6-15)13-19(26-28)27-9-11-30-12-10-27/h4,7-8,13,15H,1-3,5-6,9-12,14H2 |
| InChIKey | DNUUFEYRONAYOG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |