C21H24F6N6O — CID 177327541
6-[(Z)-1-amino-2-[amino(methyl)amino]-3,3,3-trifluoroprop-1-enyl]-4-cyclohexyl-2-[[3-(trifluoromethyl)-2-pyridinyl]methyl]pyridazin-3-one (PubChem CID 177327541) has the molecular formula C21H24F6N6O and a molecular weight of 490.45 g/mol. Its IUPAC name is 6-[(Z)-1-amino-2-[amino(methyl)amino]-3,3,3-trifluoroprop-1-enyl]-4-cyclohexyl-2-[[3-(trifluoromethyl)-2-pyridinyl]methyl]pyridazin-3-one.
| Compound Name | 6-[(Z)-1-amino-2-[amino(methyl)amino]-3,3,3-trifluoroprop-1-enyl]-4-cyclohexyl-2-[[3-(trifluoromethyl)-2-pyridinyl]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 177327541 |
| Molecular Formula | C21H24F6N6O |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 6-[(Z)-1-amino-2-[amino(methyl)amino]-3,3,3-trifluoroprop-1-enyl]-4-cyclohexyl-2-[[3-(trifluoromethyl)-2-pyridinyl]methyl]pyridazin-3-one |
| SMILES | CN(N)/C(=C(\N)c1cc(C2CCCCC2)c(=O)n(Cc2ncccc2C(F)(F)F)n1)C(F)(F)F |
| InChI | InChI=1S/C21H24F6N6O/c1-32(29)18(21(25,26)27)17(28)15-10-13(12-6-3-2-4-7-12)19(34)33(31-15)11-16-14(20(22,23)24)8-5-9-30-16/h5,8-10,12H,2-4,6-7,11,28-29H2,1H3/b18-17- |
| InChIKey | KPNUISPDZWAHRW-ZCXUNETKSA-N |
| XLogP | 3.75 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|