C17H15F5N2O — CID 177333745
6-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-5-fluoro-2-propylpyridine-3-carbaldehyde (PubChem CID 177333745) has the molecular formula C17H15F5N2O and a molecular weight of 358.31 g/mol. Its IUPAC name is 6-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-5-fluoro-2-propylpyridine-3-carbaldehyde.
| Compound Name | 6-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-5-fluoro-2-propylpyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 177333745 |
| Molecular Formula | C17H15F5N2O |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 6-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-5-fluoro-2-propylpyridine-3-carbaldehyde |
| SMILES | CCCc1nc(-c2cc(N)c(F)c(C)c2C(F)(F)F)c(F)cc1C=O |
| InChI | InChI=1S/C17H15F5N2O/c1-3-4-13-9(7-25)5-11(18)16(24-13)10-6-12(23)15(19)8(2)14(10)17(20,21)22/h5-7H,3-4,23H2,1-2H3 |
| InChIKey | TYBQFRFRNSQMKE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|