C14H14O4 — CID 177339244
1-(3-methyl-2-oxobut-3-enyl)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 177339244) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is 1-(3-methyl-2-oxobut-3-enyl)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 1-(3-methyl-2-oxobut-3-enyl)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 177339244 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 1-(3-methyl-2-oxobut-3-enyl)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | C=C(C)C(=O)CC12C=CC(C1)C1C(=O)OC(=O)C12 |
| InChI | InChI=1S/C14H14O4/c1-7(2)9(15)6-14-4-3-8(5-14)10-11(14)13(17)18-12(10)16/h3-4,8,10-11H,1,5-6H2,2H3 |
| InChIKey | HZBXBZKAWXLDAO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|