C13H12O4 — CID 177339245
1-(2-methylprop-2-enoyl)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 177339245) has the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. Its IUPAC name is 1-(2-methylprop-2-enoyl)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 1-(2-methylprop-2-enoyl)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 177339245 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 1-(2-methylprop-2-enoyl)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | C=C(C)C(=O)C12C=CC(C1)C1C(=O)OC(=O)C12 |
| InChI | InChI=1S/C13H12O4/c1-6(2)10(14)13-4-3-7(5-13)8-9(13)12(16)17-11(8)15/h3-4,7-9H,1,5H2,2H3 |
| InChIKey | HAPGZZWTEHYDNT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|