C17H26BrF3O2Si — CID 177342781
3-[[2-bromo-6-(trifluoromethyl)phenyl]methoxy]propoxy-tert-butyl-dimethylsilane (PubChem CID 177342781) has the molecular formula C17H26BrF3O2Si and a molecular weight of 427.38 g/mol. Its IUPAC name is 3-[[2-bromo-6-(trifluoromethyl)phenyl]methoxy]propoxy-tert-butyl-dimethylsilane.
| Compound Name | 3-[[2-bromo-6-(trifluoromethyl)phenyl]methoxy]propoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 177342781 |
| Molecular Formula | C17H26BrF3O2Si |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 3-[[2-bromo-6-(trifluoromethyl)phenyl]methoxy]propoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCOCc1c(Br)cccc1C(F)(F)F |
| InChI | InChI=1S/C17H26BrF3O2Si/c1-16(2,3)24(4,5)23-11-7-10-22-12-13-14(17(19,20)21)8-6-9-15(13)18/h6,8-9H,7,10-12H2,1-5H3 |
| InChIKey | VNELDPDBOBGFSC-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|