C18H14N2O3S2 — CID 177345313
3-methyl-N-(5-thiophen-3-yl-1,3-benzoxazol-2-yl)benzenesulfonamide (PubChem CID 177345313) has the molecular formula C18H14N2O3S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 3-methyl-N-(5-thiophen-3-yl-1,3-benzoxazol-2-yl)benzenesulfonamide.
| Compound Name | 3-methyl-N-(5-thiophen-3-yl-1,3-benzoxazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 177345313 |
| Molecular Formula | C18H14N2O3S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 3-methyl-N-(5-thiophen-3-yl-1,3-benzoxazol-2-yl)benzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)Nc2nc3cc(-c4ccsc4)ccc3o2)c1 |
| InChI | InChI=1S/C18H14N2O3S2/c1-12-3-2-4-15(9-12)25(21,22)20-18-19-16-10-13(5-6-17(16)23-18)14-7-8-24-11-14/h2-11H,1H3,(H,19,20) |
| InChIKey | ZOFDQFXQFBMVLK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |