C19H11F3N2O2S — CID 177345280
N-(5-thiophen-3-yl-1,3-benzoxazol-2-yl)-2-(trifluoromethyl)benzamide (PubChem CID 177345280) has the molecular formula C19H11F3N2O2S and a molecular weight of 388.37 g/mol. Its IUPAC name is N-(5-thiophen-3-yl-1,3-benzoxazol-2-yl)-2-(trifluoromethyl)benzamide.
| Compound Name | N-(5-thiophen-3-yl-1,3-benzoxazol-2-yl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 177345280 |
| Molecular Formula | C19H11F3N2O2S |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | N-(5-thiophen-3-yl-1,3-benzoxazol-2-yl)-2-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1nc2cc(-c3ccsc3)ccc2o1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H11F3N2O2S/c20-19(21,22)14-4-2-1-3-13(14)17(25)24-18-23-15-9-11(5-6-16(15)26-18)12-7-8-27-10-12/h1-10H,(H,23,24,25) |
| InChIKey | BTBNNKKNRUJFBS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |