C18H24N4OS — CID 177346116
diimino-[[2-(7-methoxyquinolin-4-yl)-2-azaspiro[3.3]heptan-6-yl]methyl]-methyl-λ6-sulfane (PubChem CID 177346116) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is diimino-[[2-(7-methoxyquinolin-4-yl)-2-azaspiro[3.3]heptan-6-yl]methyl]-methyl-λ6-sulfane.
| Compound Name | diimino-[[2-(7-methoxyquinolin-4-yl)-2-azaspiro[3.3]heptan-6-yl]methyl]-methyl-λ6-sulfane |
|---|---|
| PubChem CID | 177346116 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | diimino-[[2-(7-methoxyquinolin-4-yl)-2-azaspiro[3.3]heptan-6-yl]methyl]-methyl-λ6-sulfane |
| SMILES | [H]N=S(C)(CC1CC2(C1)CN(c1ccnc3cc(OC)ccc13)C2)=N[H] |
| InChI | InChI=1S/C18H24N4OS/c1-23-14-3-4-15-16(7-14)21-6-5-17(15)22-11-18(12-22)8-13(9-18)10-24(2,19)20/h3-7,13,19-20H,8-12H2,1-2H3 |
| InChIKey | RKQIWOVPJIKDIC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |