C19H22O3 — CID 177346142
6-tert-butyl-4,4,9-trimethyl-4aH-benzo[f][2]benzofuran-1,3-dione (PubChem CID 177346142) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 6-tert-butyl-4,4,9-trimethyl-4aH-benzo[f][2]benzofuran-1,3-dione.
| Compound Name | 6-tert-butyl-4,4,9-trimethyl-4aH-benzo[f][2]benzofuran-1,3-dione |
|---|---|
| PubChem CID | 177346142 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 6-tert-butyl-4,4,9-trimethyl-4aH-benzo[f][2]benzofuran-1,3-dione |
| SMILES | CC1=C2C=CC(C(C)(C)C)=CC2C(C)(C)C2=C1C(=O)OC2=O |
| InChI | InChI=1S/C19H22O3/c1-10-12-8-7-11(18(2,3)4)9-13(12)19(5,6)15-14(10)16(20)22-17(15)21/h7-9,13H,1-6H3 |
| InChIKey | GFRDMWJNODDRQJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|