C32H33N5O2 — CID 177349379
5-methyl-2-[4-[(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)methyl]phenyl]-3-phenyl-1,6-naphthyridine-7-carboxamide;prop-2-enal (PubChem CID 177349379) has the molecular formula C32H33N5O2 and a molecular weight of 519.65 g/mol. Its IUPAC name is 5-methyl-2-[4-[(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)methyl]phenyl]-3-phenyl-1,6-naphthyridine-7-carboxamide;prop-2-enal.
| Compound Name | 5-methyl-2-[4-[(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)methyl]phenyl]-3-phenyl-1,6-naphthyridine-7-carboxamide;prop-2-enal |
|---|---|
| PubChem CID | 177349379 |
| Molecular Formula | C32H33N5O2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 5-methyl-2-[4-[(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)methyl]phenyl]-3-phenyl-1,6-naphthyridine-7-carboxamide;prop-2-enal |
| SMILES | C=CC=O.Cc1nc(C(N)=O)cc2nc(-c3ccc(CN4CC5(CN(C)C5)C4)cc3)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C29H29N5O.C3H4O/c1-19-23-12-24(21-6-4-3-5-7-21)27(32-25(23)13-26(31-19)28(30)35)22-10-8-20(9-11-22)14-34-17-29(18-34)15-33(2)16-29;1-2-3-4/h3-13H,14-18H2,1-2H3,(H2,30,35);2-3H,1H2 |
| InChIKey | IYKRTWAGWHNXFQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|