C54H96N2O6 — CID 177353016
(13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) 8-[10,10-di(heptan-4-yloxy)decanoyl-[2-(dimethylamino)ethyl]amino]octanoate (PubChem CID 177353016) has the molecular formula C54H96N2O6 and a molecular weight of 869.37 g/mol. Its IUPAC name is (13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) 8-[10,10-di(heptan-4-yloxy)decanoyl-[2-(dimethylamino)ethyl]amino]octanoate.
| Compound Name | (13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) 8-[10,10-di(heptan-4-yloxy)decanoyl-[2-(dimethylamino)ethyl]amino]octanoate |
|---|---|
| PubChem CID | 177353016 |
| Molecular Formula | C54H96N2O6 |
| Molecular Weight | 869.37 g/mol |
| Exact Mass | 868.73 |
| IUPAC Name | (13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) 8-[10,10-di(heptan-4-yloxy)decanoyl-[2-(dimethylamino)ethyl]amino]octanoate |
| SMILES | CCCC(CCC)OC(CCCCCCCCC(=O)N(CCCCCCCC(=O)OC1CCC2C3CCC4=CC(=O)CCC4C3CCC12C)CCN(C)C)OC(CCC)CCC |
| InChI | InChI=1S/C54H96N2O6/c1-8-23-44(24-9-2)60-53(61-45(25-10-3)26-11-4)29-21-17-13-12-15-19-27-51(58)56(40-39-55(6)7)38-22-18-14-16-20-28-52(59)62-50-35-34-49-48-32-30-42-41-43(57)31-33-46(42)47(48)36-37-54(49,50)5/h41,44-50,53H,8-40H2,1-7H3 |
| InChIKey | BAIAHDGJDQRFAO-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.37 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|