C33H44FN5O2 — CID 177353472
ethane;3-fluoro-N,N,5-trimethyl-4-[1-[(2E,5E)-2-methyl-5-[4-(methylamino)-2-oxo-1-pyridinyl]-4-methylidene-7-methyliminohepta-2,5-dienyl]-3,6-dihydro-2H-pyridin-4-yl]benzamide (PubChem CID 177353472) has the molecular formula C33H44FN5O2 and a molecular weight of 561.75 g/mol. Its IUPAC name is ethane;3-fluoro-N,N,5-trimethyl-4-[1-[(2E,5E)-2-methyl-5-[4-(methylamino)-2-oxo-1-pyridinyl]-4-methylidene-7-methyliminohepta-2,5-dienyl]-3,6-dihydro-2H-pyridin-4-yl]benzamide.
| Compound Name | ethane;3-fluoro-N,N,5-trimethyl-4-[1-[(2E,5E)-2-methyl-5-[4-(methylamino)-2-oxo-1-pyridinyl]-4-methylidene-7-methyliminohepta-2,5-dienyl]-3,6-dihydro-2H-pyridin-4-yl]benzamide |
|---|---|
| PubChem CID | 177353472 |
| Molecular Formula | C33H44FN5O2 |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.35 |
| IUPAC Name | ethane;3-fluoro-N,N,5-trimethyl-4-[1-[(2E,5E)-2-methyl-5-[4-(methylamino)-2-oxo-1-pyridinyl]-4-methylidene-7-methyliminohepta-2,5-dienyl]-3,6-dihydro-2H-pyridin-4-yl]benzamide |
| SMILES | C=C(/C=C(\C)CN1CC=C(c2c(C)cc(C(=O)N(C)C)cc2F)CC1)/C(=C\C=N\C)n1ccc(NC)cc1=O.CC |
| InChI | InChI=1S/C31H38FN5O2.C2H6/c1-21(16-22(2)28(8-12-33-4)37-15-11-26(34-5)19-29(37)38)20-36-13-9-24(10-14-36)30-23(3)17-25(18-27(30)32)31(39)35(6)7;1-2/h8-9,11-12,15-19,34H,2,10,13-14,20H2,1,3-7H3;1-2H3/b21-16+,28-8+,33-12+; |
| InChIKey | OFMOYAJPBMGMFL-YFRKRCATSA-N |
| XLogP | 5.90 |
| TPSA | 69.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|