C24H30BrFN3OP — CID 177354182
4-[1-[(2E,5E)-5-bromo-2-methyl-4-methylidene-7-methyliminohepta-2,5-dienyl]-3,6-dihydro-2H-pyridin-4-yl]-3-fluoro-N,N-dimethyl-5-phosphanylbenzamide (PubChem CID 177354182) has the molecular formula C24H30BrFN3OP and a molecular weight of 506.40 g/mol. Its IUPAC name is 4-[1-[(2E,5E)-5-bromo-2-methyl-4-methylidene-7-methyliminohepta-2,5-dienyl]-3,6-dihydro-2H-pyridin-4-yl]-3-fluoro-N,N-dimethyl-5-phosphanylbenzamide.
| Compound Name | 4-[1-[(2E,5E)-5-bromo-2-methyl-4-methylidene-7-methyliminohepta-2,5-dienyl]-3,6-dihydro-2H-pyridin-4-yl]-3-fluoro-N,N-dimethyl-5-phosphanylbenzamide |
|---|---|
| PubChem CID | 177354182 |
| Molecular Formula | C24H30BrFN3OP |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 4-[1-[(2E,5E)-5-bromo-2-methyl-4-methylidene-7-methyliminohepta-2,5-dienyl]-3,6-dihydro-2H-pyridin-4-yl]-3-fluoro-N,N-dimethyl-5-phosphanylbenzamide |
| SMILES | C=C(/C=C(\C)CN1CC=C(c2c(F)cc(C(=O)N(C)C)cc2P)CC1)/C(Br)=C\C=N\C |
| InChI | InChI=1S/C24H30BrFN3OP/c1-16(12-17(2)20(25)6-9-27-3)15-29-10-7-18(8-11-29)23-21(26)13-19(14-22(23)31)24(30)28(4)5/h6-7,9,12-14H,2,8,10-11,15,31H2,1,3-5H3/b16-12+,20-6+,27-9+ |
| InChIKey | KWZRCSAWYQDFBB-VIAPHLSPSA-N |
| XLogP | 4.60 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|