C19H34N2O — CID 177354297
4-(1-amino-5-methylhexan-3-yl)-N,N-dimethylbenzamide;propane (PubChem CID 177354297) has the molecular formula C19H34N2O and a molecular weight of 306.49 g/mol. Its IUPAC name is 4-(1-amino-5-methylhexan-3-yl)-N,N-dimethylbenzamide;propane.
| Compound Name | 4-(1-amino-5-methylhexan-3-yl)-N,N-dimethylbenzamide;propane |
|---|---|
| PubChem CID | 177354297 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | 4-(1-amino-5-methylhexan-3-yl)-N,N-dimethylbenzamide;propane |
| SMILES | CC(C)CC(CCN)c1ccc(C(=O)N(C)C)cc1.CCC |
| InChI | InChI=1S/C16H26N2O.C3H8/c1-12(2)11-15(9-10-17)13-5-7-14(8-6-13)16(19)18(3)4;1-3-2/h5-8,12,15H,9-11,17H2,1-4H3;3H2,1-2H3 |
| InChIKey | KPWKHUWUYDAUFL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |