C29H36N4O — CID 177354382
1-[4-[1-[(3E,6E)-6-(6-amino-3-pyridinyl)-3-methyl-5-methylidene-8-methyliminoocta-3,6-dien-2-yl]piperidin-4-yl]phenyl]ethanone (PubChem CID 177354382) has the molecular formula C29H36N4O and a molecular weight of 456.63 g/mol. Its IUPAC name is 1-[4-[1-[(3E,6E)-6-(6-amino-3-pyridinyl)-3-methyl-5-methylidene-8-methyliminoocta-3,6-dien-2-yl]piperidin-4-yl]phenyl]ethanone.
| Compound Name | 1-[4-[1-[(3E,6E)-6-(6-amino-3-pyridinyl)-3-methyl-5-methylidene-8-methyliminoocta-3,6-dien-2-yl]piperidin-4-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 177354382 |
| Molecular Formula | C29H36N4O |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 1-[4-[1-[(3E,6E)-6-(6-amino-3-pyridinyl)-3-methyl-5-methylidene-8-methyliminoocta-3,6-dien-2-yl]piperidin-4-yl]phenyl]ethanone |
| SMILES | C=C(/C=C(\C)C(C)N1CCC(c2ccc(C(C)=O)cc2)CC1)/C(=C\C=N\C)c1ccc(N)nc1 |
| InChI | InChI=1S/C29H36N4O/c1-20(18-21(2)28(12-15-31-5)27-10-11-29(30)32-19-27)22(3)33-16-13-26(14-17-33)25-8-6-24(7-9-25)23(4)34/h6-12,15,18-19,22,26H,2,13-14,16-17H2,1,3-5H3,(H2,30,32)/b20-18+,28-12+,31-15+ |
| InChIKey | CXWFBHIZJAMSKR-FTRPTXSTSA-N |
| XLogP | 5.72 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|