C17H32FN3O — CID 177355208
2-[[(2Z)-2-(dipropylamino)-3-fluoropenta-2,4-dienyl]amino]-N-methylpentanamide (PubChem CID 177355208) has the molecular formula C17H32FN3O and a molecular weight of 313.46 g/mol. Its IUPAC name is 2-[[(2Z)-2-(dipropylamino)-3-fluoropenta-2,4-dienyl]amino]-N-methylpentanamide.
| Compound Name | 2-[[(2Z)-2-(dipropylamino)-3-fluoropenta-2,4-dienyl]amino]-N-methylpentanamide |
|---|---|
| PubChem CID | 177355208 |
| Molecular Formula | C17H32FN3O |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | 2-[[(2Z)-2-(dipropylamino)-3-fluoropenta-2,4-dienyl]amino]-N-methylpentanamide |
| SMILES | C=C/C(F)=C(\CNC(CCC)C(=O)NC)N(CCC)CCC |
| InChI | InChI=1S/C17H32FN3O/c1-6-10-15(17(22)19-5)20-13-16(14(18)9-4)21(11-7-2)12-8-3/h9,15,20H,4,6-8,10-13H2,1-3,5H3,(H,19,22)/b16-14- |
| InChIKey | IYCDCKWFHNPDAZ-PEZBUJJGSA-N |
| XLogP | 2.98 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|