C17H34N2O — CID 178083110
ethane;N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-(methylamino)pentanamide (PubChem CID 178083110) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is ethane;N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-(methylamino)pentanamide.
| Compound Name | ethane;N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 178083110 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | ethane;N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-(methylamino)pentanamide |
| SMILES | C=C/C=C\C(=C/C)NC(=O)C(CCC)NC.CC.CC |
| InChI | InChI=1S/C13H22N2O.2C2H6/c1-5-8-10-11(7-3)15-13(16)12(14-4)9-6-2;2*1-2/h5,7-8,10,12,14H,1,6,9H2,2-4H3,(H,15,16);2*1-2H3/b10-8-,11-7+;; |
| InChIKey | QXIREMJRPSIWSG-IMVFXIOZSA-N |
| XLogP | 4.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|