C12H17FN2O — CID 143541698
N-[(2E,4E)-5-fluorohepta-2,4,6-trien-2-yl]pyrrolidine-2-carboxamide (PubChem CID 143541698) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is N-[(2E,4E)-5-fluorohepta-2,4,6-trien-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(2E,4E)-5-fluorohepta-2,4,6-trien-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143541698 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-[(2E,4E)-5-fluorohepta-2,4,6-trien-2-yl]pyrrolidine-2-carboxamide |
| SMILES | C=C/C(F)=C\C=C(/C)NC(=O)C1CCCN1 |
| InChI | InChI=1S/C12H17FN2O/c1-3-10(13)7-6-9(2)15-12(16)11-5-4-8-14-11/h3,6-7,11,14H,1,4-5,8H2,2H3,(H,15,16)/b9-6+,10-7+ |
| InChIKey | MIBZBMMFWMQQJJ-KZZDLZNXSA-N |
| XLogP | 1.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|